C31H35F2NO3 — CID 170706730
(5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6-(4-methylphenyl)-6,7-dihydro-5H-naphthalen-2-ol (PubChem CID 170706730) has the molecular formula C31H35F2NO3 and a molecular weight of 507.62 g/mol. Its IUPAC name is (5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6-(4-methylphenyl)-6,7-dihydro-5H-naphthalen-2-ol.
| Compound Name | (5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6-(4-methylphenyl)-6,7-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 170706730 |
| Molecular Formula | C31H35F2NO3 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | (5S,6R)-5-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-8,8-difluoro-6-(4-methylphenyl)-6,7-dihydro-5H-naphthalen-2-ol |
| SMILES | COC(OC)C1CCN(c2ccc([C@H]3c4ccc(O)cc4C(F)(F)C[C@H]3c3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H35F2NO3/c1-20-4-6-21(7-5-20)27-19-31(32,33)28-18-25(35)12-13-26(28)29(27)22-8-10-24(11-9-22)34-16-14-23(15-17-34)30(36-2)37-3/h4-13,18,23,27,29-30,35H,14-17,19H2,1-3H3/t27-,29-/m0/s1 |
| InChIKey | ARXUBVKDIJTFSC-YTMVLYRLSA-N |
| XLogP | 6.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|