C13H14F3N — CID 170718536
2-phenyl-4-(2,2,2-trifluoroethylidene)piperidine (PubChem CID 170718536) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is 2-phenyl-4-(2,2,2-trifluoroethylidene)piperidine.
| Compound Name | 2-phenyl-4-(2,2,2-trifluoroethylidene)piperidine |
|---|---|
| PubChem CID | 170718536 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-phenyl-4-(2,2,2-trifluoroethylidene)piperidine |
| SMILES | FC(F)(F)C=C1CCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C13H14F3N/c14-13(15,16)9-10-6-7-17-12(8-10)11-4-2-1-3-5-11/h1-5,9,12,17H,6-8H2 |
| InChIKey | QEBXUDGNUVADMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|