C14H21F2N — CID 170733996
(5E,7E)-2-(difluoromethyl)-N,5,8-trimethyldeca-1,5,7-trien-4-imine (PubChem CID 170733996) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is (5E,7E)-2-(difluoromethyl)-N,5,8-trimethyldeca-1,5,7-trien-4-imine.
| Compound Name | (5E,7E)-2-(difluoromethyl)-N,5,8-trimethyldeca-1,5,7-trien-4-imine |
|---|---|
| PubChem CID | 170733996 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (5E,7E)-2-(difluoromethyl)-N,5,8-trimethyldeca-1,5,7-trien-4-imine |
| SMILES | C=C(CC(=N\C)/C(C)=C/C=C(\C)CC)C(F)F |
| InChI | InChI=1S/C14H21F2N/c1-6-10(2)7-8-11(3)13(17-5)9-12(4)14(15)16/h7-8,14H,4,6,9H2,1-3,5H3/b10-7+,11-8+,17-13+ |
| InChIKey | GSWXQKOCAJNTOU-AGCZFBHISA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|