C54H103N5O4 — CID 170755057
4-[3-[bis(8-oxooctyl)amino]propylamino]pyrimidine-2-carbonitrile;9-methoxyheptadecane;3-methoxyundecane (PubChem CID 170755057) has the molecular formula C54H103N5O4 and a molecular weight of 886.45 g/mol. Its IUPAC name is 4-[3-[bis(8-oxooctyl)amino]propylamino]pyrimidine-2-carbonitrile;9-methoxyheptadecane;3-methoxyundecane.
| Compound Name | 4-[3-[bis(8-oxooctyl)amino]propylamino]pyrimidine-2-carbonitrile;9-methoxyheptadecane;3-methoxyundecane |
|---|---|
| PubChem CID | 170755057 |
| Molecular Formula | C54H103N5O4 |
| Molecular Weight | 886.45 g/mol |
| Exact Mass | 885.80 |
| IUPAC Name | 4-[3-[bis(8-oxooctyl)amino]propylamino]pyrimidine-2-carbonitrile;9-methoxyheptadecane;3-methoxyundecane |
| SMILES | CCCCCCCCC(CC)OC.CCCCCCCCC(CCCCCCCC)OC.N#Cc1nccc(NCCCN(CCCCCCCC=O)CCCCCCCC=O)n1 |
| InChI | InChI=1S/C24H39N5O2.C18H38O.C12H26O/c25-22-24-27-16-14-23(28-24)26-15-13-19-29(17-9-5-1-3-7-11-20-30)18-10-6-2-4-8-12-21-31;1-4-6-8-10-12-14-16-18(19-3)17-15-13-11-9-7-5-2;1-4-6-7-8-9-10-11-12(5-2)13-3/h14,16,20-21H,1-13,15,17-19H2,(H,26,27,28);18H,4-17H2,1-3H3;12H,4-11H2,1-3H3 |
| InChIKey | MQUYYIFGOKBATC-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.45 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|