About CID 170847208
CID 170847208 (PubChem CID 170847208) has the molecular formula C26H18N2NaO6S
and a molecular weight of 509.50 g/mol.
Molecular Properties
| Compound Name | CID 170847208 |
| PubChem CID | 170847208 |
| Molecular Formula | C26H18N2NaO6S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | — |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(Nc3ccccc3)cc(NOS(=O)(=O)c3ccccc3)c21.[Na] |
| InChI | InChI=1S/C26H18N2O6S.Na/c29-24-18-13-7-8-14-19(18)25(30)23-22(24)20(28-34-35(32,33)17-11-5-2-6-12-17)15-21(26(23)31)27-16-9-3-1-4-10-16;/h1-15,27-28,31H; |
| InChIKey | IOQKSJVEXQIWDM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 170847208 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170847208?
The IUPAC name of CID 170847208 (CID 170847208) is not available.
What is the SMILES notation for CID 170847208?
The canonical SMILES for CID 170847208 is O=C1c2ccccc2C(=O)c2c(O)c(Nc3ccccc3)cc(NOS(=O)(=O)c3ccccc3)c21.[Na].
What is the InChIKey of CID 170847208?
The InChIKey is IOQKSJVEXQIWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N2O6S.Na/c29-24-18-13-7-8-14-19(18)25(30)23-22(24)20(28-34-35(32,33)17-11-5-2-6-12-17)15-21(26(23)31)27-16-9-3-1-4-10-16;/h1-15,27-28,31H;.
What are the key properties of CID 170847208?
CID 170847208 has a molecular weight of 509.50 g/mol, XLogP of 4.26, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170847208 is sourced from PubChem (CID 170847208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).