C24H21NO10S3 — CID 90724436
2-[3-[(4-methyl-3-methylsulfonyl-9,10-dioxoanthracen-1-yl)amino]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 90724436) has the molecular formula C24H21NO10S3 and a molecular weight of 579.63 g/mol. Its IUPAC name is 2-[3-[(4-methyl-3-methylsulfonyl-9,10-dioxoanthracen-1-yl)amino]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[3-[(4-methyl-3-methylsulfonyl-9,10-dioxoanthracen-1-yl)amino]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 90724436 |
| Molecular Formula | C24H21NO10S3 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | 2-[3-[(4-methyl-3-methylsulfonyl-9,10-dioxoanthracen-1-yl)amino]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | Cc1c(S(C)(=O)=O)cc(Nc2cccc(S(=O)(=O)CCOS(=O)(=O)O)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H21NO10S3/c1-14-20(36(2,28)29)13-19(22-21(14)23(26)17-8-3-4-9-18(17)24(22)27)25-15-6-5-7-16(12-15)37(30,31)11-10-35-38(32,33)34/h3-9,12-13,25H,10-11H2,1-2H3,(H,32,33,34) |
| InChIKey | QIHHWKVHAXISOW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 178.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|