C24H30O6 — CID 170988614
(1R,5S,8R)-2-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-1,3,5-trimethyl-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione (PubChem CID 170988614) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (1R,5S,8R)-2-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-1,3,5-trimethyl-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione.
| Compound Name | (1R,5S,8R)-2-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-1,3,5-trimethyl-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
|---|---|
| PubChem CID | 170988614 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1R,5S,8R)-2-[(3E,5E)-7-hydroxy-2-oxohepta-3,5-dienyl]-1,3,5-trimethyl-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
| SMILES | C/C=C/CCC(=O)C[C@@H]1[C@@]2(C)C(=O)O[C@]1(C)C(=O)C(C)=C2CC(=O)/C=C/C=C/CO |
| InChI | InChI=1S/C24H30O6/c1-5-6-8-11-18(27)15-20-23(3)19(14-17(26)12-9-7-10-13-25)16(2)21(28)24(20,4)30-22(23)29/h5-7,9-10,12,20,25H,8,11,13-15H2,1-4H3/b6-5+,10-7+,12-9+/t20-,23+,24+/m1/s1 |
| InChIKey | VKORGSCQZWLHFK-IAPHUFFGSA-N |
| XLogP | 3.20 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|