C33H28F6FeNOP — CID 171370030
cyclopenta-1,3-diene;N-(1-cyclopenta-1,3-dien-1-yl-2-diphenylphosphanylethyl)-3,5-bis(trifluoromethyl)benzamide;iron (PubChem CID 171370030) has the molecular formula C33H28F6FeNOP and a molecular weight of 655.40 g/mol. Its IUPAC name is cyclopenta-1,3-diene;N-(1-cyclopenta-1,3-dien-1-yl-2-diphenylphosphanylethyl)-3,5-bis(trifluoromethyl)benzamide;iron.
| Compound Name | cyclopenta-1,3-diene;N-(1-cyclopenta-1,3-dien-1-yl-2-diphenylphosphanylethyl)-3,5-bis(trifluoromethyl)benzamide;iron |
|---|---|
| PubChem CID | 171370030 |
| Molecular Formula | C33H28F6FeNOP |
| Molecular Weight | 655.40 g/mol |
| Exact Mass | 655.12 |
| IUPAC Name | cyclopenta-1,3-diene;N-(1-cyclopenta-1,3-dien-1-yl-2-diphenylphosphanylethyl)-3,5-bis(trifluoromethyl)benzamide;iron |
| SMILES | C1=CCC=C1.O=C(NC(CP(c1ccccc1)c1ccccc1)C1=CC=CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Fe] |
| InChI | InChI=1S/C28H22F6NOP.C5H6.Fe/c29-27(30,31)21-15-20(16-22(17-21)28(32,33)34)26(36)35-25(19-9-7-8-10-19)18-37(23-11-3-1-4-12-23)24-13-5-2-6-14-24;1-2-4-5-3-1;/h1-9,11-17,25H,10,18H2,(H,35,36);1-4H,5H2; |
| InChIKey | RFIPCNOCXJRDJZ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.40 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|