C19H25F3N4O5SSi — CID 171614917
[5-cyano-2-(3-hydroxy-3-methylazetidin-1-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 171614917) has the molecular formula C19H25F3N4O5SSi and a molecular weight of 506.58 g/mol. Its IUPAC name is [5-cyano-2-(3-hydroxy-3-methylazetidin-1-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [5-cyano-2-(3-hydroxy-3-methylazetidin-1-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171614917 |
| Molecular Formula | C19H25F3N4O5SSi |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [5-cyano-2-(3-hydroxy-3-methylazetidin-1-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | CC1(O)CN(c2cc3c(OS(=O)(=O)C(F)(F)F)c(C#N)cnc3n2COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C19H25F3N4O5SSi/c1-18(27)10-25(11-18)15-7-14-16(31-32(28,29)19(20,21)22)13(8-23)9-24-17(14)26(15)12-30-5-6-33(2,3)4/h7,9,27H,5-6,10-12H2,1-4H3 |
| InChIKey | CNKDVMHMRGKRJS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|