C8H11N4O2+ — CID 172510532
(diaminomethylideneamino)-[(2,3-dihydroxyphenyl)methylidene]azanium (PubChem CID 172510532) has the molecular formula C8H11N4O2+ and a molecular weight of 195.20 g/mol. Its IUPAC name is (diaminomethylideneamino)-[(2,3-dihydroxyphenyl)methylidene]azanium.
| Compound Name | (diaminomethylideneamino)-[(2,3-dihydroxyphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 172510532 |
| Molecular Formula | C8H11N4O2+ |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (diaminomethylideneamino)-[(2,3-dihydroxyphenyl)methylidene]azanium |
| SMILES | NC(N)=N[NH+]=Cc1cccc(O)c1O |
| InChI | InChI=1S/C8H10N4O2/c9-8(10)12-11-4-5-2-1-3-6(13)7(5)14/h1-4,13-14H,(H4,9,10,12)/p+1 |
| InChIKey | ATEHHUARMAXMJM-UHFFFAOYSA-O |
| XLogP | -2.21 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|