C8H2F15NO2S — CID 172701890
1,2,2,2-tetrafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanesulfonamide (PubChem CID 172701890) has the molecular formula C8H2F15NO2S and a molecular weight of 461.15 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanesulfonamide.
| Compound Name | 1,2,2,2-tetrafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanesulfonamide |
|---|---|
| PubChem CID | 172701890 |
| Molecular Formula | C8H2F15NO2S |
| Molecular Weight | 461.15 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | 1,2,2,2-tetrafluoro-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethanesulfonamide |
| SMILES | NS(=O)(=O)C(F)(C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H2F15NO2S/c9-1(7(20,8(21,22)23)27(24,25)26)2(10,11)4(14,15)6(18,19)5(16,17)3(1,12)13/h(H2,24,25,26) |
| InChIKey | DBLYYHSJKBBCIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|