C9F18O3S — CID 87672927
1,1,2,2,2-pentafluoroethyl difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methanesulfonate (PubChem CID 87672927) has the molecular formula C9F18O3S and a molecular weight of 530.13 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methanesulfonate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methanesulfonate |
|---|---|
| PubChem CID | 87672927 |
| Molecular Formula | C9F18O3S |
| Molecular Weight | 530.13 g/mol |
| Exact Mass | 529.93 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl difluoro-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)methanesulfonate |
| SMILES | O=S(=O)(OC(F)(F)C(F)(F)F)C(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9F18O3S/c10-1(9(26,27)31(28,29)30-8(24,25)7(21,22)23)2(11,12)4(15,16)6(19,20)5(17,18)3(1,13)14 |
| InChIKey | PNXIMESVIFUERC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.13 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|