C43H49N3O — CID 172857955
[2-cyano-2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]ethenylidene]azanide (PubChem CID 172857955) has the molecular formula C43H49N3O and a molecular weight of 623.89 g/mol. Its IUPAC name is [2-cyano-2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]ethenylidene]azanide.
| Compound Name | [2-cyano-2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]ethenylidene]azanide |
|---|---|
| PubChem CID | 172857955 |
| Molecular Formula | C43H49N3O |
| Molecular Weight | 623.89 g/mol |
| Exact Mass | 623.39 |
| IUPAC Name | [2-cyano-2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]ethenylidene]azanide |
| SMILES | CCCCC(CC)C[n+]1ccc(-c2ccc3c(c2)C(CCCC)(CCCC)c2cc(-c4ccc(C(=C=[N-])C#N)cc4)ccc2O3)cc1 |
| InChI | InChI=1S/C43H49N3O/c1-5-9-12-32(8-4)31-46-25-21-35(22-26-46)37-18-20-42-40(28-37)43(23-10-6-2,24-11-7-3)39-27-36(17-19-41(39)47-42)33-13-15-34(16-14-33)38(29-44)30-45/h13-22,25-28,32H,5-12,23-24,31H2,1-4H3 |
| InChIKey | YYURLJVIXKHENA-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.89 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|