C43H50N3O+ — CID 166055587
2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]-2-isocyanoethenimine (PubChem CID 166055587) has the molecular formula C43H50N3O+ and a molecular weight of 624.89 g/mol. Its IUPAC name is 2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]-2-isocyanoethenimine.
| Compound Name | 2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]-2-isocyanoethenimine |
|---|---|
| PubChem CID | 166055587 |
| Molecular Formula | C43H50N3O+ |
| Molecular Weight | 624.89 g/mol |
| Exact Mass | 624.39 |
| IUPAC Name | 2-[4-[9,9-dibutyl-7-[1-(2-ethylhexyl)pyridin-1-ium-4-yl]xanthen-2-yl]phenyl]-2-isocyanoethenimine |
| SMILES | [C-]#[N+]C(=C=N)c1ccc(-c2ccc3c(c2)C(CCCC)(CCCC)c2cc(-c4cc[n+](CC(CC)CCCC)cc4)ccc2O3)cc1 |
| InChI | InChI=1S/C43H50N3O/c1-6-10-13-32(9-4)31-46-26-22-34(23-27-46)37-19-21-42-39(29-37)43(24-11-7-2,25-12-8-3)38-28-36(18-20-41(38)47-42)33-14-16-35(17-15-33)40(30-44)45-5/h14-23,26-29,32,44H,6-13,24-25,31H2,1-4H3/q+1 |
| InChIKey | FVTWUUVWHQSGCH-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 41.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.89 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|