C15H23F3O4S2 — CID 173027760
6-(2-bicyclo[2.2.1]heptanyl)-2-methyl-2-sulfanylcyclohexan-1-one;trifluoromethanesulfonic acid (PubChem CID 173027760) has the molecular formula C15H23F3O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]heptanyl)-2-methyl-2-sulfanylcyclohexan-1-one;trifluoromethanesulfonic acid.
| Compound Name | 6-(2-bicyclo[2.2.1]heptanyl)-2-methyl-2-sulfanylcyclohexan-1-one;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173027760 |
| Molecular Formula | C15H23F3O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]heptanyl)-2-methyl-2-sulfanylcyclohexan-1-one;trifluoromethanesulfonic acid |
| SMILES | CC1(S)CCCC(C2CC3CCC2C3)C1=O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C14H22OS.CHF3O3S/c1-14(16)6-2-3-11(13(14)15)12-8-9-4-5-10(12)7-9;2-1(3,4)8(5,6)7/h9-12,16H,2-8H2,1H3;(H,5,6,7) |
| InChIKey | GUBYZMWJXQHWIA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|