C18H25ClN4O4S — CID 173069366
5-[[2-[3-(2-aminoethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 173069366) has the molecular formula C18H25ClN4O4S and a molecular weight of 428.94 g/mol. Its IUPAC name is 5-[[2-[3-(2-aminoethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-[[2-[3-(2-aminoethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 173069366 |
| Molecular Formula | C18H25ClN4O4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 5-[[2-[3-(2-aminoethylamino)pyrrolidin-1-yl]-4,5-dimethoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)c(N2CCC(NCCN)C2)cc1OC.Cl |
| InChI | InChI=1S/C18H24N4O4S.ClH/c1-25-14-7-11(8-16-17(23)21-18(24)27-16)13(9-15(14)26-2)22-6-3-12(10-22)20-5-4-19;/h7-9,12,20H,3-6,10,19H2,1-2H3,(H,21,23,24);1H |
| InChIKey | OSJPQVIKUKBSNI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|