C8H5F2N2S+ — CID 173081995
2,4-difluoro-6-thiophen-2-ylpyrimidin-1-ium (PubChem CID 173081995) has the molecular formula C8H5F2N2S+ and a molecular weight of 199.21 g/mol. Its IUPAC name is 2,4-difluoro-6-thiophen-2-ylpyrimidin-1-ium.
| Compound Name | 2,4-difluoro-6-thiophen-2-ylpyrimidin-1-ium |
|---|---|
| PubChem CID | 173081995 |
| Molecular Formula | C8H5F2N2S+ |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 2,4-difluoro-6-thiophen-2-ylpyrimidin-1-ium |
| SMILES | Fc1cc(-c2cccs2)[nH+]c(F)n1 |
| InChI | InChI=1S/C8H4F2N2S/c9-7-4-5(11-8(10)12-7)6-2-1-3-13-6/h1-4H/p+1 |
| InChIKey | KGUMBMSKTFHBSC-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |