C10H14N2O12Pt — CID 173094368
bis(ethanediperoxoate);platinum(4+);trans-(1R,2R)-cyclohexane-1,2-diamine (PubChem CID 173094368) has the molecular formula C10H14N2O12Pt and a molecular weight of 549.30 g/mol. Its IUPAC name is bis(ethanediperoxoate);platinum(4+);trans-(1R,2R)-cyclohexane-1,2-diamine.
| Compound Name | bis(ethanediperoxoate);platinum(4+);trans-(1R,2R)-cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 173094368 |
| Molecular Formula | C10H14N2O12Pt |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 549.02 |
| IUPAC Name | bis(ethanediperoxoate);platinum(4+);trans-(1R,2R)-cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1N.O=C(O[O-])C(=O)O[O-].O=C(O[O-])C(=O)O[O-].[Pt+4] |
| InChI | InChI=1S/C6H14N2.2C2H2O6.Pt/c7-5-3-1-2-4-6(5)8;2*3-1(7-5)2(4)8-6;/h5-6H,1-4,7-8H2;2*5-6H;/q;;;+4/p-4/t5-,6-;;;/m1.../s1 |
| InChIKey | UPJMTNWAXOYEGX-SKSSAGQDSA-J |
| XLogP | -6.54 |
| TPSA | 249.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | -6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|