C27H44O3 — CID 173263974
[(2E)-3,7-dimethylocta-2,6-dienyl] 5,9,13-trimethyltetradeca-4,8,12-trieneperoxoate (PubChem CID 173263974) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 5,9,13-trimethyltetradeca-4,8,12-trieneperoxoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 5,9,13-trimethyltetradeca-4,8,12-trieneperoxoate |
|---|---|
| PubChem CID | 173263974 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 5,9,13-trimethyltetradeca-4,8,12-trieneperoxoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(=O)OOC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C27H44O3/c1-22(2)12-8-14-24(5)16-10-17-25(6)18-11-19-27(28)30-29-21-20-26(7)15-9-13-23(3)4/h12-13,16,18,20H,8-11,14-15,17,19,21H2,1-7H3/b24-16?,25-18?,26-20+ |
| InChIKey | RDUAOYBIQNROKB-MTKKCIHRSA-N |
| XLogP | 8.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|