C18H21Cl2NO — CID 173282264
2,2-dichloro-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]-1-phenylethanone (PubChem CID 173282264) has the molecular formula C18H21Cl2NO and a molecular weight of 338.28 g/mol. Its IUPAC name is 2,2-dichloro-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]-1-phenylethanone.
| Compound Name | 2,2-dichloro-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]-1-phenylethanone |
|---|---|
| PubChem CID | 173282264 |
| Molecular Formula | C18H21Cl2NO |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2,2-dichloro-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]-1-phenylethanone |
| SMILES | CN(CC=CC#CC(C)(C)C)C(Cl)(Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21Cl2NO/c1-17(2,3)13-9-6-10-14-21(4)18(19,20)16(22)15-11-7-5-8-12-15/h5-8,10-12H,14H2,1-4H3 |
| InChIKey | YXBRMWBDLBJWMJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|