C18H32NO5P — CID 173331262
1-[aminooxy(3,7,11-trimethyldodeca-2,6,10-trienylperoxy)phosphoryl]propan-2-one (PubChem CID 173331262) has the molecular formula C18H32NO5P and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[aminooxy(3,7,11-trimethyldodeca-2,6,10-trienylperoxy)phosphoryl]propan-2-one.
| Compound Name | 1-[aminooxy(3,7,11-trimethyldodeca-2,6,10-trienylperoxy)phosphoryl]propan-2-one |
|---|---|
| PubChem CID | 173331262 |
| Molecular Formula | C18H32NO5P |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-[aminooxy(3,7,11-trimethyldodeca-2,6,10-trienylperoxy)phosphoryl]propan-2-one |
| SMILES | CC(=O)CP(=O)(ON)OOCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C18H32NO5P/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-24-25(21,23-19)14-18(5)20/h8,10,12H,6-7,9,11,13-14,19H2,1-5H3 |
| InChIKey | UHKRPXRUSMUUFW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|