C28H44N4O3S — CID 173479698
N-[(2R)-1-cyclohexylbutan-2-yl]-4-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-1-oxido-1,2,5-thiadiazol-1-ium-3-imine (PubChem CID 173479698) has the molecular formula C28H44N4O3S and a molecular weight of 516.75 g/mol. Its IUPAC name is N-[(2R)-1-cyclohexylbutan-2-yl]-4-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-1-oxido-1,2,5-thiadiazol-1-ium-3-imine.
| Compound Name | N-[(2R)-1-cyclohexylbutan-2-yl]-4-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-1-oxido-1,2,5-thiadiazol-1-ium-3-imine |
|---|---|
| PubChem CID | 173479698 |
| Molecular Formula | C28H44N4O3S |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | N-[(2R)-1-cyclohexylbutan-2-yl]-4-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-1-oxido-1,2,5-thiadiazol-1-ium-3-imine |
| SMILES | CC[C@H](CC1CCCCC1)/N=c1\[nH][s+]([O-])nc1N1CCCC(C(OCCCOC)c2ccccc2)C1 |
| InChI | InChI=1S/C28H44N4O3S/c1-3-25(20-22-12-6-4-7-13-22)29-27-28(31-36(33)30-27)32-17-10-16-24(21-32)26(35-19-11-18-34-2)23-14-8-5-9-15-23/h5,8-9,14-15,22,24-26H,3-4,6-7,10-13,16-21H2,1-2H3,(H,29,30)/t24?,25-,26?,36?/m1/s1 |
| InChIKey | UKARQJNJOBTTSH-WGQYCQMISA-N |
| XLogP | 5.80 |
| TPSA | 85.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|