C23H38BN3O5 — CID 174106256
(5R)-2-(2-aminopropanoyl)-8-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,6-diazabicyclo[3.2.1]octane-5-carboxylic acid (PubChem CID 174106256) has the molecular formula C23H38BN3O5 and a molecular weight of 447.39 g/mol. Its IUPAC name is (5R)-2-(2-aminopropanoyl)-8-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,6-diazabicyclo[3.2.1]octane-5-carboxylic acid.
| Compound Name | (5R)-2-(2-aminopropanoyl)-8-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,6-diazabicyclo[3.2.1]octane-5-carboxylic acid |
|---|---|
| PubChem CID | 174106256 |
| Molecular Formula | C23H38BN3O5 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | (5R)-2-(2-aminopropanoyl)-8-[3-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]-2,6-diazabicyclo[3.2.1]octane-5-carboxylic acid |
| SMILES | CC(N)C(=O)N1CC[C@@]2(C(=O)O)NCC1C2CCCB1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C23H38BN3O5/c1-13(25)19(28)27-9-7-23(20(29)30)15(16(27)12-26-23)6-5-8-24-31-18-11-14-10-17(21(14,2)3)22(18,4)32-24/h13-18,26H,5-12,25H2,1-4H3,(H,29,30)/t13?,14-,15?,16?,17-,18+,22-,23+/m0/s1 |
| InChIKey | OKKNBRNOUKFGDF-FZOVFNLZSA-N |
| XLogP | 1.49 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|