C23H32O4 — CID 174306879
1-ethenyl-2,4-bis(prop-1-en-2-yl)cyclohexane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174306879) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-ethenyl-2,4-bis(prop-1-en-2-yl)cyclohexane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-ethenyl-2,4-bis(prop-1-en-2-yl)cyclohexane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174306879 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-ethenyl-2,4-bis(prop-1-en-2-yl)cyclohexane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C=CC1CCC(C(=C)C)CC1C(=C)C.CC1(C(=O)O)C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C14H22.C9H10O4/c1-6-12-7-8-13(10(2)3)9-14(12)11(4)5;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h6,12-14H,1-2,4,7-9H2,3,5H3;2-4H,5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | PBSCLFSQNVSOEK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|