C44H40N8O6 — CID 174357136
N-[[4-[(4-amino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methyl]-3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]propanamide (PubChem CID 174357136) has the molecular formula C44H40N8O6 and a molecular weight of 776.85 g/mol. Its IUPAC name is N-[[4-[(4-amino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methyl]-3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]propanamide.
| Compound Name | N-[[4-[(4-amino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methyl]-3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]propanamide |
|---|---|
| PubChem CID | 174357136 |
| Molecular Formula | C44H40N8O6 |
| Molecular Weight | 776.85 g/mol |
| Exact Mass | 776.31 |
| IUPAC Name | N-[[4-[(4-amino-5,6-diphenylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]phenyl]methyl]-3-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]propanamide |
| SMILES | Nc1ncnc2c1c(-c1ccccc1)c(-c1ccccc1)n2Cc1ccc(CNC(=O)CCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C44H40N8O6/c45-40-38-36(29-8-3-1-4-9-29)39(30-10-5-2-6-11-30)51(41(38)49-26-48-40)25-28-16-14-27(15-17-28)24-47-34(53)20-22-58-23-21-46-32-13-7-12-31-37(32)44(57)52(43(31)56)33-18-19-35(54)50-42(33)55/h1-17,26,33,46H,18-25H2,(H,47,53)(H2,45,48,49)(H,50,54,55) |
| InChIKey | ZSXSBLYVQNLANO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 190.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|