C16H21F3NO5S- — CID 174358875
1-(sulfinatocarbamoyl)-3-(2,3,3-trifluorobutoxycarbonyl)adamantane (PubChem CID 174358875) has the molecular formula C16H21F3NO5S- and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-(sulfinatocarbamoyl)-3-(2,3,3-trifluorobutoxycarbonyl)adamantane.
| Compound Name | 1-(sulfinatocarbamoyl)-3-(2,3,3-trifluorobutoxycarbonyl)adamantane |
|---|---|
| PubChem CID | 174358875 |
| Molecular Formula | C16H21F3NO5S- |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-(sulfinatocarbamoyl)-3-(2,3,3-trifluorobutoxycarbonyl)adamantane |
| SMILES | CC(F)(F)C(F)COC(=O)C12CC3CC(CC(C(=O)NS(=O)[O-])(C3)C1)C2 |
| InChI | InChI=1S/C16H22F3NO5S/c1-14(18,19)11(17)7-25-13(22)16-5-9-2-10(6-16)4-15(3-9,8-16)12(21)20-26(23)24/h9-11H,2-8H2,1H3,(H,20,21)(H,23,24)/p-1 |
| InChIKey | QORFABKKGUBKPN-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|