About ethanol;ethyl acetate;2-nonylphenol
ethanol;ethyl acetate;2-nonylphenol (PubChem CID 174437442) has the molecular formula C21H38O4
and a molecular weight of 354.53 g/mol. Its IUPAC name is ethanol;ethyl acetate;2-nonylphenol.
Molecular Properties
| Compound Name | ethanol;ethyl acetate;2-nonylphenol |
| PubChem CID | 174437442 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | ethanol;ethyl acetate;2-nonylphenol |
| SMILES | CCCCCCCCCc1ccccc1O.CCO.CCOC(C)=O |
| InChI | InChI=1S/C15H24O.C4H8O2.C2H6O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-3-6-4(2)5;1-2-3/h9-10,12-13,16H,2-8,11H2,1H3;3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | NTFDEHLNOJBBQP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethanol;ethyl acetate;2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl acetate;2-nonylphenol?
The IUPAC name of ethanol;ethyl acetate;2-nonylphenol (CID 174437442) is ethanol;ethyl acetate;2-nonylphenol.
What is the SMILES notation for ethanol;ethyl acetate;2-nonylphenol?
The canonical SMILES for ethanol;ethyl acetate;2-nonylphenol is CCCCCCCCCc1ccccc1O.CCO.CCOC(C)=O.
What is the InChIKey of ethanol;ethyl acetate;2-nonylphenol?
The InChIKey is NTFDEHLNOJBBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C4H8O2.C2H6O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-3-6-4(2)5;1-2-3/h9-10,12-13,16H,2-8,11H2,1H3;3H2,1-2H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl acetate;2-nonylphenol?
ethanol;ethyl acetate;2-nonylphenol has a molecular weight of 354.53 g/mol, XLogP of 5.25, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl acetate;2-nonylphenol is sourced from PubChem (CID 174437442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).