C6H7N3O4S — CID 174643309
1,3-oxazolidine-2,4-dione;2-sulfanylideneimidazolidin-4-one (PubChem CID 174643309) has the molecular formula C6H7N3O4S and a molecular weight of 217.21 g/mol. Its IUPAC name is 1,3-oxazolidine-2,4-dione;2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1,3-oxazolidine-2,4-dione;2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 174643309 |
| Molecular Formula | C6H7N3O4S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 1,3-oxazolidine-2,4-dione;2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1CNC(=S)N1.O=C1COC(=O)N1 |
| InChI | InChI=1S/C3H4N2OS.C3H3NO3/c6-2-1-4-3(7)5-2;5-2-1-7-3(6)4-2/h1H2,(H2,4,5,6,7);1H2,(H,4,5,6) |
| InChIKey | OVQBHZYCWFWELT-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|