About 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate
2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate (PubChem CID 174701302) has the molecular formula C6H9ClN4O2S2
and a molecular weight of 268.75 g/mol. Its IUPAC name is 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate.
Molecular Properties
| Compound Name | 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate |
| PubChem CID | 174701302 |
| Molecular Formula | C6H9ClN4O2S2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate |
| SMILES | Clc1nccs1.[H]/N=C(\SC)N(C)[N+](=O)[O-] |
| InChI | InChI=1S/C3H2ClNS.C3H7N3O2S/c4-3-5-1-2-6-3;1-5(6(7)8)3(4)9-2/h1-2H;4H,1-2H3/b;4-3- |
| InChIKey | SVDVBLFDKBNSFJ-QGAMPUOQSA-N |
| XLogP | 2.20 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate?
The IUPAC name of 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate (CID 174701302) is 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate.
What is the SMILES notation for 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate?
The canonical SMILES for 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate is Clc1nccs1.[H]/N=C(\SC)N(C)[N+](=O)[O-].
What is the InChIKey of 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate?
The InChIKey is SVDVBLFDKBNSFJ-QGAMPUOQSA-N. The full InChI is InChI=1S/C3H2ClNS.C3H7N3O2S/c4-3-5-1-2-6-3;1-5(6(7)8)3(4)9-2/h1-2H;4H,1-2H3/b;4-3-.
What are the key properties of 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate?
2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate has a molecular weight of 268.75 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-thiazole;methyl N-methyl-N-nitrocarbamimidothioate is sourced from PubChem (CID 174701302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).