C11H12N2O2 — CID 174749885
benzene-1,3-diol;2,2-dimethylpropanedinitrile (PubChem CID 174749885) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is benzene-1,3-diol;2,2-dimethylpropanedinitrile.
| Compound Name | benzene-1,3-diol;2,2-dimethylpropanedinitrile |
|---|---|
| PubChem CID | 174749885 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | benzene-1,3-diol;2,2-dimethylpropanedinitrile |
| SMILES | CC(C)(C#N)C#N.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.C5H6N2/c7-5-2-1-3-6(8)4-5;1-5(2,3-6)4-7/h1-4,7-8H;1-2H3 |
| InChIKey | HRSRASHZZGEMNH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |