About N-benzylformamide;quinoline
N-benzylformamide;quinoline (PubChem CID 174801934) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is N-benzylformamide;quinoline.
Molecular Properties
| Compound Name | N-benzylformamide;quinoline |
| PubChem CID | 174801934 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-benzylformamide;quinoline |
| SMILES | O=CNCc1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H9NO/c1-2-6-9-8(4-1)5-3-7-10-9;10-7-9-6-8-4-2-1-3-5-8/h1-7H;1-5,7H,6H2,(H,9,10) |
| InChIKey | JSXDUJJHQUJDDJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-benzylformamide;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylformamide;quinoline?
The IUPAC name of N-benzylformamide;quinoline (CID 174801934) is N-benzylformamide;quinoline.
What is the SMILES notation for N-benzylformamide;quinoline?
The canonical SMILES for N-benzylformamide;quinoline is O=CNCc1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of N-benzylformamide;quinoline?
The InChIKey is JSXDUJJHQUJDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H9NO/c1-2-6-9-8(4-1)5-3-7-10-9;10-7-9-6-8-4-2-1-3-5-8/h1-7H;1-5,7H,6H2,(H,9,10).
What are the key properties of N-benzylformamide;quinoline?
N-benzylformamide;quinoline has a molecular weight of 264.33 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylformamide;quinoline is sourced from PubChem (CID 174801934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).