About 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene
1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene (PubChem CID 174817952) has the molecular formula C23H22N2
and a molecular weight of 326.44 g/mol. Its IUPAC name is 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene.
Molecular Properties
| Compound Name | 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene |
| PubChem CID | 174817952 |
| Molecular Formula | C23H22N2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene |
| SMILES | C=CCc1cccc(Cc2ccccc2)c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C16H16.C7H6N2/c1-2-7-14-10-6-11-16(12-14)13-15-8-4-3-5-9-15;1-2-4-7-6(3-1)8-5-9-7/h2-6,8-12H,1,7,13H2;1-5H,(H,8,9) |
| InChIKey | NOXDVIXDJOVYRW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene?
The IUPAC name of 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene (CID 174817952) is 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene.
What is the SMILES notation for 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene?
The canonical SMILES for 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene is C=CCc1cccc(Cc2ccccc2)c1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene?
The InChIKey is NOXDVIXDJOVYRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16.C7H6N2/c1-2-7-14-10-6-11-16(12-14)13-15-8-4-3-5-9-15;1-2-4-7-6(3-1)8-5-9-7/h2-6,8-12H,1,7,13H2;1-5H,(H,8,9).
What are the key properties of 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene?
1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene has a molecular weight of 326.44 g/mol, XLogP of 5.57, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;1-benzyl-3-prop-2-enylbenzene is sourced from PubChem (CID 174817952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).