C10H18AuO10S — CID 174820286
gold;2,3,4,5,6-pentahydroxyhexanal;2-sulfanylbutanedioic acid (PubChem CID 174820286) has the molecular formula C10H18AuO10S and a molecular weight of 527.28 g/mol. Its IUPAC name is gold;2,3,4,5,6-pentahydroxyhexanal;2-sulfanylbutanedioic acid.
| Compound Name | gold;2,3,4,5,6-pentahydroxyhexanal;2-sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 174820286 |
| Molecular Formula | C10H18AuO10S |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | gold;2,3,4,5,6-pentahydroxyhexanal;2-sulfanylbutanedioic acid |
| SMILES | O=C(O)CC(S)C(=O)O.O=CC(O)C(O)C(O)C(O)CO.[Au] |
| InChI | InChI=1S/C6H12O6.C4H6O4S.Au/c7-1-3(9)5(11)6(12)4(10)2-8;5-3(6)1-2(9)4(7)8;/h1,3-6,8-12H,2H2;2,9H,1H2,(H,5,6)(H,7,8); |
| InChIKey | WXQHWGSQBUDMPW-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|