About 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride
2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride (PubChem CID 174919977) has the molecular formula C15H18ClN3O
and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride.
Molecular Properties
| Compound Name | 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride |
| PubChem CID | 174919977 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride |
| SMILES | Cl.Cn1ccnc1CCO.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H10N2O.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;1-8-4-3-7-6(8)2-5-9;/h1-7H;3-4,9H,2,5H2,1H3;1H |
| InChIKey | FRNYRTIUSGYIAE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride?
The IUPAC name of 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride (CID 174919977) is 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride.
What is the SMILES notation for 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride?
The canonical SMILES for 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride is Cl.Cn1ccnc1CCO.c1ccc2ncccc2c1.
What is the InChIKey of 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride?
The InChIKey is FRNYRTIUSGYIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H10N2O.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;1-8-4-3-7-6(8)2-5-9;/h1-7H;3-4,9H,2,5H2,1H3;1H.
What are the key properties of 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride?
2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride has a molecular weight of 291.78 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylimidazol-2-yl)ethanol;quinoline;hydrochloride is sourced from PubChem (CID 174919977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).