C24H28O2 — CID 174946397
[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)ethenyl]phenyl] formate (PubChem CID 174946397) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is [4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)ethenyl]phenyl] formate.
| Compound Name | [4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)ethenyl]phenyl] formate |
|---|---|
| PubChem CID | 174946397 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-1-yl)ethenyl]phenyl] formate |
| SMILES | C=C(c1ccc(OC=O)cc1)c1cc(C)cc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28O2/c1-16-13-20(17(2)18-7-9-19(10-8-18)26-15-25)22-21(14-16)23(3,4)11-12-24(22,5)6/h7-10,13-15H,2,11-12H2,1,3-6H3 |
| InChIKey | FAMWMRWRHRHMFC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|