C5H12Cl2N3Ti — CID 175066147
methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;titanium(3+);dichloride (PubChem CID 175066147) has the molecular formula C5H12Cl2N3Ti and a molecular weight of 232.94 g/mol. Its IUPAC name is methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;titanium(3+);dichloride.
| Compound Name | methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;titanium(3+);dichloride |
|---|---|
| PubChem CID | 175066147 |
| Molecular Formula | C5H12Cl2N3Ti |
| Molecular Weight | 232.94 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | methyl-(N,N,N'-trimethylcarbamimidoyl)azanide;titanium(3+);dichloride |
| SMILES | C/N=C(/[N-]C)N(C)C.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C5H12N3.2ClH.Ti/c1-6-5(7-2)8(3)4;;;/h1-4H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | XWWQXKZXLPTDFD-UHFFFAOYSA-L |
| XLogP | -5.46 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.94 |
| LogP ≤ 5 | -5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|