C16H16O — CID 175123032
5-methoxy-5-methyl-2-(2-phenylethynyl)cyclohexa-1,3-diene (PubChem CID 175123032) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-methoxy-5-methyl-2-(2-phenylethynyl)cyclohexa-1,3-diene.
| Compound Name | 5-methoxy-5-methyl-2-(2-phenylethynyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175123032 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 5-methoxy-5-methyl-2-(2-phenylethynyl)cyclohexa-1,3-diene |
| SMILES | COC1(C)C=CC(C#Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C16H16O/c1-16(17-2)12-10-15(11-13-16)9-8-14-6-4-3-5-7-14/h3-7,10-12H,13H2,1-2H3 |
| InChIKey | CEEGANPKIBRDDB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|