C20H19IO4 — CID 177434144
3-iodo-7,7,8,8-tetramethoxy-4-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 177434144) has the molecular formula C20H19IO4 and a molecular weight of 450.27 g/mol. Its IUPAC name is 3-iodo-7,7,8,8-tetramethoxy-4-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-iodo-7,7,8,8-tetramethoxy-4-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 177434144 |
| Molecular Formula | C20H19IO4 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 3-iodo-7,7,8,8-tetramethoxy-4-(2-phenylethynyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | COC1(OC)c2cc(I)c(C#Cc3ccccc3)cc2C1(OC)OC |
| InChI | InChI=1S/C20H19IO4/c1-22-19(23-2)16-12-15(11-10-14-8-6-5-7-9-14)18(21)13-17(16)20(19,24-3)25-4/h5-9,12-13H,1-4H3 |
| InChIKey | WGQATNUYVHTGNH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|