C35H37N3O10 — CID 175178407
2-amino-3-phenylpropanoic acid;2-(dihydroxyamino)-3-phenylpropanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)acetic acid (PubChem CID 175178407) has the molecular formula C35H37N3O10 and a molecular weight of 659.69 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;2-(dihydroxyamino)-3-phenylpropanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)acetic acid.
| Compound Name | 2-amino-3-phenylpropanoic acid;2-(dihydroxyamino)-3-phenylpropanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 175178407 |
| Molecular Formula | C35H37N3O10 |
| Molecular Weight | 659.69 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;2-(dihydroxyamino)-3-phenylpropanoic acid;2-(9H-fluoren-1-ylmethoxycarbonylamino)acetic acid |
| SMILES | NC(Cc1ccccc1)C(=O)O.O=C(O)C(Cc1ccccc1)N(O)O.O=C(O)CNC(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C17H15NO4.C9H11NO4.C9H11NO2/c19-16(20)9-18-17(21)22-10-12-5-3-7-14-13-6-2-1-4-11(13)8-15(12)14;11-9(12)8(10(13)14)6-7-4-2-1-3-5-7;10-8(9(11)12)6-7-4-2-1-3-5-7/h1-7H,8-10H2,(H,18,21)(H,19,20);1-5,8,13-14H,6H2,(H,11,12);1-5,8H,6,10H2,(H,11,12) |
| InChIKey | USKJPBKARJBVIX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 219.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|