About potassium;1-fluoro-3-methanidylbenzene;trifluoroborane
potassium;1-fluoro-3-methanidylbenzene;trifluoroborane (PubChem CID 175220113) has the molecular formula C7H6BF4K
and a molecular weight of 216.03 g/mol. Its IUPAC name is potassium;1-fluoro-3-methanidylbenzene;trifluoroborane.
Molecular Properties
| Compound Name | potassium;1-fluoro-3-methanidylbenzene;trifluoroborane |
| PubChem CID | 175220113 |
| Molecular Formula | C7H6BF4K |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | potassium;1-fluoro-3-methanidylbenzene;trifluoroborane |
| SMILES | FB(F)F.[CH2-]c1cccc(F)c1.[K+] |
| InChI | InChI=1S/C7H6F.BF3.K/c1-6-3-2-4-7(8)5-6;2-1(3)4;/h2-5H,1H2;;/q-1;;+1 |
| InChIKey | NMIVFSYVXZRZAJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-fluoro-3-methanidylbenzene;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-fluoro-3-methanidylbenzene;trifluoroborane?
The IUPAC name of potassium;1-fluoro-3-methanidylbenzene;trifluoroborane (CID 175220113) is potassium;1-fluoro-3-methanidylbenzene;trifluoroborane.
What is the SMILES notation for potassium;1-fluoro-3-methanidylbenzene;trifluoroborane?
The canonical SMILES for potassium;1-fluoro-3-methanidylbenzene;trifluoroborane is FB(F)F.[CH2-]c1cccc(F)c1.[K+].
What is the InChIKey of potassium;1-fluoro-3-methanidylbenzene;trifluoroborane?
The InChIKey is NMIVFSYVXZRZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F.BF3.K/c1-6-3-2-4-7(8)5-6;2-1(3)4;/h2-5H,1H2;;/q-1;;+1.
What are the key properties of potassium;1-fluoro-3-methanidylbenzene;trifluoroborane?
potassium;1-fluoro-3-methanidylbenzene;trifluoroborane has a molecular weight of 216.03 g/mol, XLogP of -0.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-fluoro-3-methanidylbenzene;trifluoroborane is sourced from PubChem (CID 175220113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).