About hexane-2,4-dione;triethoxysilane
hexane-2,4-dione;triethoxysilane (PubChem CID 175224475) has the molecular formula C12H26O5Si
and a molecular weight of 278.42 g/mol. Its IUPAC name is hexane-2,4-dione;triethoxysilane.
Molecular Properties
| Compound Name | hexane-2,4-dione;triethoxysilane |
| PubChem CID | 175224475 |
| Molecular Formula | C12H26O5Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | hexane-2,4-dione;triethoxysilane |
| SMILES | CCC(=O)CC(C)=O.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H16O3Si.C6H10O2/c1-4-7-10(8-5-2)9-6-3;1-3-6(8)4-5(2)7/h10H,4-6H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | DFJUTDMGVBPPMY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexane-2,4-dione;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-2,4-dione;triethoxysilane?
The IUPAC name of hexane-2,4-dione;triethoxysilane (CID 175224475) is hexane-2,4-dione;triethoxysilane.
What is the SMILES notation for hexane-2,4-dione;triethoxysilane?
The canonical SMILES for hexane-2,4-dione;triethoxysilane is CCC(=O)CC(C)=O.CCO[SiH](OCC)OCC.
What is the InChIKey of hexane-2,4-dione;triethoxysilane?
The InChIKey is DFJUTDMGVBPPMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C6H10O2/c1-4-7-10(8-5-2)9-6-3;1-3-6(8)4-5(2)7/h10H,4-6H2,1-3H3;3-4H2,1-2H3.
What are the key properties of hexane-2,4-dione;triethoxysilane?
hexane-2,4-dione;triethoxysilane has a molecular weight of 278.42 g/mol, XLogP of 1.76, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-2,4-dione;triethoxysilane is sourced from PubChem (CID 175224475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).