C6H10N2O4 — CID 175334286
(2S)-2-(2-iminoethylamino)butanedioic acid (PubChem CID 175334286) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is (2S)-2-(2-iminoethylamino)butanedioic acid.
| Compound Name | (2S)-2-(2-iminoethylamino)butanedioic acid |
|---|---|
| PubChem CID | 175334286 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (2S)-2-(2-iminoethylamino)butanedioic acid |
| SMILES | [H]/N=C/CN[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10N2O4/c7-1-2-8-4(6(11)12)3-5(9)10/h1,4,7-8H,2-3H2,(H,9,10)(H,11,12)/b7-1+/t4-/m0/s1 |
| InChIKey | LIEGGBDTZJGLGY-VWBMFRBOSA-N |
| XLogP | -0.85 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|