C23H24ClF2N5O3S — CID 175595925
(3R)-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoropiperidin-1-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine (PubChem CID 175595925) has the molecular formula C23H24ClF2N5O3S and a molecular weight of 523.99 g/mol. Its IUPAC name is (3R)-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoropiperidin-1-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine.
| Compound Name | (3R)-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoropiperidin-1-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine |
|---|---|
| PubChem CID | 175595925 |
| Molecular Formula | C23H24ClF2N5O3S |
| Molecular Weight | 523.99 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | (3R)-5-[(4-chlorophenyl)methyl]-7-[5-(4,4-difluoropiperidin-1-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine |
| SMILES | N[C@@H]1CN(Cc2ccc(Cl)cc2)c2cc(-c3nnc(N4CCC(F)(F)CC4)o3)ccc2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H24ClF2N5O3S/c24-17-4-1-15(2-5-17)12-31-13-18(27)14-35(32,33)20-6-3-16(11-19(20)31)21-28-29-22(34-21)30-9-7-23(25,26)8-10-30/h1-6,11,18H,7-10,12-14,27H2/t18-/m1/s1 |
| InChIKey | SMICJKONXQOIAE-GOSISDBHSA-N |
| XLogP | 3.75 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |