C21H36N4O11 — CID 175631466
[5-acetamido-3,4-diacetyloxy-6-[2-[3-[2-(2-aminoacetyl)hydrazinyl]propoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 175631466) has the molecular formula C21H36N4O11 and a molecular weight of 520.54 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-[2-[3-[2-(2-aminoacetyl)hydrazinyl]propoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-[2-[3-[2-(2-aminoacetyl)hydrazinyl]propoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175631466 |
| Molecular Formula | C21H36N4O11 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-[2-[3-[2-(2-aminoacetyl)hydrazinyl]propoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OCCOCCCNNC(=O)CN)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H36N4O11/c1-12(26)24-18-20(35-15(4)29)19(34-14(3)28)16(11-33-13(2)27)36-21(18)32-9-8-31-7-5-6-23-25-17(30)10-22/h16,18-21,23H,5-11,22H2,1-4H3,(H,24,26)(H,25,30) |
| InChIKey | MZDWURDOWTWVPS-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 202.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|