About CID 175884329
CID 175884329 (PubChem CID 175884329) has the molecular formula C5H4K2O5
and a molecular weight of 222.28 g/mol.
Molecular Properties
| Compound Name | CID 175884329 |
| PubChem CID | 175884329 |
| Molecular Formula | C5H4K2O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 221.93 |
| IUPAC Name | — |
| SMILES | O=C1C(=O)C(O)C(O)C1=O.[K].[K] |
| InChI | InChI=1S/C5H4O5.2K/c6-1-2(7)4(9)5(10)3(1)8;;/h1-2,6-7H;; |
| InChIKey | NITHKNWCMAZMDC-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 175884329 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175884329?
The IUPAC name of CID 175884329 (CID 175884329) is not available.
What is the SMILES notation for CID 175884329?
The canonical SMILES for CID 175884329 is O=C1C(=O)C(O)C(O)C1=O.[K].[K].
What is the InChIKey of CID 175884329?
The InChIKey is NITHKNWCMAZMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O5.2K/c6-1-2(7)4(9)5(10)3(1)8;;/h1-2,6-7H;;.
What are the key properties of CID 175884329?
CID 175884329 has a molecular weight of 222.28 g/mol, XLogP of -3.33, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175884329 is sourced from PubChem (CID 175884329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).