C30H45N7O5Si — CID 175916488
tert-butyl 2-[2-(1-methylpyrazol-4-yl)-5-nitro-4-(propan-2-ylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 175916488) has the molecular formula C30H45N7O5Si and a molecular weight of 611.82 g/mol. Its IUPAC name is tert-butyl 2-[2-(1-methylpyrazol-4-yl)-5-nitro-4-(propan-2-ylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(1-methylpyrazol-4-yl)-5-nitro-4-(propan-2-ylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 175916488 |
| Molecular Formula | C30H45N7O5Si |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | tert-butyl 2-[2-(1-methylpyrazol-4-yl)-5-nitro-4-(propan-2-ylamino)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)Nc1c([N+](=O)[O-])cnc2c1c(C1CC=CCN1C(=O)OC(C)(C)C)c(-c1cnn(C)c1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C30H45N7O5Si/c1-20(2)33-26-23(37(39)40)17-31-28-25(26)24(22-12-10-11-13-35(22)29(38)42-30(3,4)5)27(21-16-32-34(6)18-21)36(28)19-41-14-15-43(7,8)9/h10-11,16-18,20,22H,12-15,19H2,1-9H3,(H,31,33) |
| InChIKey | LBXAVMDLYKNLMI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|