About 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol
3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol (PubChem CID 175923075) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol.
Molecular Properties
| Compound Name | 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol |
| PubChem CID | 175923075 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol |
| SMILES | Oc1ccc2c(c1)CCc1c(-c3ccccc3)c[nH]c1-2 |
| InChI | InChI=1S/C18H15NO/c20-14-7-9-15-13(10-14)6-8-16-17(11-19-18(15)16)12-4-2-1-3-5-12/h1-5,7,9-11,19-20H,6,8H2 |
| InChIKey | ZOIOUEBFGHWASB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol?
The IUPAC name of 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol (CID 175923075) is 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol.
What is the SMILES notation for 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol?
The canonical SMILES for 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol is Oc1ccc2c(c1)CCc1c(-c3ccccc3)c[nH]c1-2.
What is the InChIKey of 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol?
The InChIKey is ZOIOUEBFGHWASB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO/c20-14-7-9-15-13(10-14)6-8-16-17(11-19-18(15)16)12-4-2-1-3-5-12/h1-5,7,9-11,19-20H,6,8H2.
What are the key properties of 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol?
3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol has a molecular weight of 261.32 g/mol, XLogP of 4.15, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-4,5-dihydro-1H-benzo[g]indol-7-ol is sourced from PubChem (CID 175923075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).