C22H25N5O7 — CID 175936876
2-tert-butyl-4-[2-(3,5-dioxopiperazin-2-yl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylic acid (PubChem CID 175936876) has the molecular formula C22H25N5O7 and a molecular weight of 471.47 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-(3,5-dioxopiperazin-2-yl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[2-(3,5-dioxopiperazin-2-yl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175936876 |
| Molecular Formula | C22H25N5O7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-tert-butyl-4-[2-(3,5-dioxopiperazin-2-yl)-1,3-dioxoisoindole-5-carbonyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)c2ccc3c(c2)C(=O)N(C2NCC(=O)NC2=O)C3=O)CCN1C(=O)O |
| InChI | InChI=1S/C22H25N5O7/c1-22(2,3)14-10-25(6-7-26(14)21(33)34)18(30)11-4-5-12-13(8-11)20(32)27(19(12)31)16-17(29)24-15(28)9-23-16/h4-5,8,14,16,23H,6-7,9-10H2,1-3H3,(H,33,34)(H,24,28,29) |
| InChIKey | GUBZFYAHRLAFBV-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|