About 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine
1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine (PubChem CID 176527609) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine.
Analyze 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine?
The IUPAC name of 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine (CID 176527609) is 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine.
What is the SMILES notation for 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine?
The canonical SMILES for 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine is C=C=C(NC)NCC.
What is the InChIKey of 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine?
The InChIKey is PBWGZYPICGDRCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-4-6(7-3)8-5-2/h7-8H,1,5H2,2-3H3.
What are the key properties of 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine?
1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine has a molecular weight of 112.18 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-ethyl-1-N-methylpropa-1,2-diene-1,1-diamine is sourced from PubChem (CID 176527609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).