C17H16N2S — CID 176542321
4-[2-(3H-1,3-benzothiazol-2-ylidene)ethenyl]-N,N-dimethylaniline (PubChem CID 176542321) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-[2-(3H-1,3-benzothiazol-2-ylidene)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(3H-1,3-benzothiazol-2-ylidene)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 176542321 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-[2-(3H-1,3-benzothiazol-2-ylidene)ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=C=C2Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C17H16N2S/c1-19(2)14-10-7-13(8-11-14)9-12-17-18-15-5-3-4-6-16(15)20-17/h3-11,18H,1-2H3 |
| InChIKey | UOTQHOWSLZQYQP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|